C16H17F3O2S — CID 20693030
5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxane (PubChem CID 20693030) has the molecular formula C16H17F3O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxane.
| Compound Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20693030 |
| Molecular Formula | C16H17F3O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C16H17F3O2S/c1-22-14-10-20-15(21-11-14)5-3-2-4-12-6-8-13(9-7-12)16(17,18)19/h2-9,14-15H,10-11H2,1H3/b4-2+,5-3+ |
| InChIKey | OODHBTNGBSRZDI-ZUVMSYQZSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|