C18H19F3O2S2 — CID 20692936
difluoromethylidene-fluoro-[4-[(1E,3E,5E)-6-(5-methylsulfanyl-1,3-dioxan-2-yl)hexa-1,3,5-trienyl]phenyl]-λ4-sulfane (PubChem CID 20692936) has the molecular formula C18H19F3O2S2 and a molecular weight of 388.48 g/mol. Its IUPAC name is difluoromethylidene-fluoro-[4-[(1E,3E,5E)-6-(5-methylsulfanyl-1,3-dioxan-2-yl)hexa-1,3,5-trienyl]phenyl]-λ4-sulfane.
| Compound Name | difluoromethylidene-fluoro-[4-[(1E,3E,5E)-6-(5-methylsulfanyl-1,3-dioxan-2-yl)hexa-1,3,5-trienyl]phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 20692936 |
| Molecular Formula | C18H19F3O2S2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | difluoromethylidene-fluoro-[4-[(1E,3E,5E)-6-(5-methylsulfanyl-1,3-dioxan-2-yl)hexa-1,3,5-trienyl]phenyl]-λ4-sulfane |
| SMILES | CSC1COC(/C=C/C=C/C=C/c2ccc(S(F)=C(F)F)cc2)OC1 |
| InChI | InChI=1S/C18H19F3O2S2/c1-24-15-12-22-17(23-13-15)7-5-3-2-4-6-14-8-10-16(11-9-14)25(21)18(19)20/h2-11,15,17H,12-13H2,1H3/b3-2+,6-4+,7-5+ |
| InChIKey | VBXYBHOHBRDAQT-NYYLHBDNSA-N |
| XLogP | 5.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|