C17H17F3O3S — CID 18363337
S-[2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] ethanethioate (PubChem CID 18363337) has the molecular formula C17H17F3O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is S-[2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] ethanethioate.
| Compound Name | S-[2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] ethanethioate |
|---|---|
| PubChem CID | 18363337 |
| Molecular Formula | C17H17F3O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | S-[2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] ethanethioate |
| SMILES | CC(=O)SC1COC(/C=C/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C17H17F3O3S/c1-12(21)24-15-10-22-16(23-11-15)5-3-2-4-13-6-8-14(9-7-13)17(18,19)20/h2-9,15-16H,10-11H2,1H3/b4-2+,5-3+ |
| InChIKey | ZUZYAAMPNIQHLX-ZUVMSYQZSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|