C13H13F3O2 — CID 102486493
(4R)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolan-2-ol (PubChem CID 102486493) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is (4R)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolan-2-ol.
| Compound Name | (4R)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolan-2-ol |
|---|---|
| PubChem CID | 102486493 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (4R)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolan-2-ol |
| SMILES | OC1C[C@H](/C=C/c2ccc(C(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/C13H13F3O2/c14-13(15,16)11-5-3-9(4-6-11)1-2-10-7-12(17)18-8-10/h1-6,10,12,17H,7-8H2/b2-1+/t10-,12?/m0/s1 |
| InChIKey | HEBBCRJNPGMBJV-CAMUUFDLSA-N |
| XLogP | 3.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |