C19H25F3OSi — CID 15418783
[(1S,2R,5S)-2-ethenyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]oxy-trimethylsilane (PubChem CID 15418783) has the molecular formula C19H25F3OSi and a molecular weight of 354.49 g/mol. Its IUPAC name is [(1S,2R,5S)-2-ethenyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]oxy-trimethylsilane.
| Compound Name | [(1S,2R,5S)-2-ethenyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15418783 |
| Molecular Formula | C19H25F3OSi |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(1S,2R,5S)-2-ethenyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]oxy-trimethylsilane |
| SMILES | C=C[C@H]1CC[C@@H](/C=C/c2ccc(C(F)(F)F)cc2)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C19H25F3OSi/c1-5-15-10-11-16(18(15)23-24(2,3)4)9-6-14-7-12-17(13-8-14)19(20,21)22/h5-9,12-13,15-16,18H,1,10-11H2,2-4H3/b9-6+/t15-,16+,18-/m0/s1 |
| InChIKey | JEDRTXFNUAXVEK-AEYOSRCWSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|