C17H19F3O — CID 129214429
1-[(1S,2S,5R)-2-ethenyl-5-[(Z)-prop-1-enyl]cyclopentyl]oxy-4-(trifluoromethyl)benzene (PubChem CID 129214429) has the molecular formula C17H19F3O and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[(1S,2S,5R)-2-ethenyl-5-[(Z)-prop-1-enyl]cyclopentyl]oxy-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1S,2S,5R)-2-ethenyl-5-[(Z)-prop-1-enyl]cyclopentyl]oxy-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 129214429 |
| Molecular Formula | C17H19F3O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[(1S,2S,5R)-2-ethenyl-5-[(Z)-prop-1-enyl]cyclopentyl]oxy-4-(trifluoromethyl)benzene |
| SMILES | C=C[C@@H]1CC[C@H](/C=C\C)[C@H]1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3O/c1-3-5-13-7-6-12(4-2)16(13)21-15-10-8-14(9-11-15)17(18,19)20/h3-5,8-13,16H,2,6-7H2,1H3/b5-3-/t12-,13+,16+/m1/s1 |
| InChIKey | UIJHHHJPZJLJKM-CIPOBDSESA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|