C18H21F3O — CID 121277043
1-[(1S,2R,5S)-2-[(Z)-but-1-enyl]-5-ethenylcyclopentyl]oxy-4-(trifluoromethyl)benzene (PubChem CID 121277043) has the molecular formula C18H21F3O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-[(1S,2R,5S)-2-[(Z)-but-1-enyl]-5-ethenylcyclopentyl]oxy-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1S,2R,5S)-2-[(Z)-but-1-enyl]-5-ethenylcyclopentyl]oxy-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 121277043 |
| Molecular Formula | C18H21F3O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[(1S,2R,5S)-2-[(Z)-but-1-enyl]-5-ethenylcyclopentyl]oxy-4-(trifluoromethyl)benzene |
| SMILES | C=C[C@@H]1CC[C@H](/C=C\CC)[C@H]1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3O/c1-3-5-6-14-8-7-13(4-2)17(14)22-16-11-9-15(10-12-16)18(19,20)21/h4-6,9-14,17H,2-3,7-8H2,1H3/b6-5-/t13-,14+,17+/m1/s1 |
| InChIKey | FXEPPJKOBLSDCG-MHAFSIBPSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|