C13H14ClF3O2 — CID 113439942
1-(3-chloro-2-ethoxycyclobutyl)oxy-4-(trifluoromethyl)benzene (PubChem CID 113439942) has the molecular formula C13H14ClF3O2 and a molecular weight of 294.70 g/mol. Its IUPAC name is 1-(3-chloro-2-ethoxycyclobutyl)oxy-4-(trifluoromethyl)benzene.
| Compound Name | 1-(3-chloro-2-ethoxycyclobutyl)oxy-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 113439942 |
| Molecular Formula | C13H14ClF3O2 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-(3-chloro-2-ethoxycyclobutyl)oxy-4-(trifluoromethyl)benzene |
| SMILES | CCOC1C(Cl)CC1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14ClF3O2/c1-2-18-12-10(14)7-11(12)19-9-5-3-8(4-6-9)13(15,16)17/h3-6,10-12H,2,7H2,1H3 |
| InChIKey | HOGJJJIXYQBGIQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|