C13H13BrClF3O3 — CID 102715069
2-bromo-4-(3-chloro-2-ethoxycyclobutyl)oxy-1-(trifluoromethoxy)benzene (PubChem CID 102715069) has the molecular formula C13H13BrClF3O3 and a molecular weight of 389.60 g/mol. Its IUPAC name is 2-bromo-4-(3-chloro-2-ethoxycyclobutyl)oxy-1-(trifluoromethoxy)benzene.
| Compound Name | 2-bromo-4-(3-chloro-2-ethoxycyclobutyl)oxy-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 102715069 |
| Molecular Formula | C13H13BrClF3O3 |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 2-bromo-4-(3-chloro-2-ethoxycyclobutyl)oxy-1-(trifluoromethoxy)benzene |
| SMILES | CCOC1C(Cl)CC1Oc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H13BrClF3O3/c1-2-19-12-9(15)6-11(12)20-7-3-4-10(8(14)5-7)21-13(16,17)18/h3-5,9,11-12H,2,6H2,1H3 |
| InChIKey | RJKKOZFVGADBPA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|