C17H19F3O2S — CID 20693033
5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-1,3-dioxane (PubChem CID 20693033) has the molecular formula C17H19F3O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-1,3-dioxane.
| Compound Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20693033 |
| Molecular Formula | C17H19F3O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C(\C)c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C17H19F3O2S/c1-12(13-6-8-14(9-7-13)17(18,19)20)4-3-5-16-21-10-15(23-2)11-22-16/h3-9,15-16H,10-11H2,1-2H3/b5-3+,12-4+ |
| InChIKey | JWSAMUQOCXNUKR-KNHODELZSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|