C13H12ClF3 — CID 88787675
1-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]-4-(trifluoromethyl)benzene (PubChem CID 88787675) has the molecular formula C13H12ClF3 and a molecular weight of 260.69 g/mol. Its IUPAC name is 1-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 88787675 |
| Molecular Formula | C13H12ClF3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]-4-(trifluoromethyl)benzene |
| SMILES | CC(C)=C/C=C(\Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12ClF3/c1-9(2)3-8-12(14)10-4-6-11(7-5-10)13(15,16)17/h3-8H,1-2H3/b12-8- |
| InChIKey | ZFAJJBJWGYDLFC-WQLSENKSSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|