C12H13ClO — CID 163484573
4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol (PubChem CID 163484573) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol.
| Compound Name | 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 163484573 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol |
| SMILES | CC(C)=C/C=C(\Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H13ClO/c1-9(2)3-8-12(13)10-4-6-11(14)7-5-10/h3-8,14H,1-2H3/b12-8- |
| InChIKey | CHMFCXONFHJQAH-WQLSENKSSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|