About 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol
4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol (PubChem CID 163484573) has the molecular formula C12H13ClO
and a molecular weight of 208.69 g/mol. Its IUPAC name is 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol.
Molecular Properties
| Compound Name | 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol |
| PubChem CID | 163484573 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol |
| SMILES | CC(C)=C/C=C(\Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H13ClO/c1-9(2)3-8-12(13)10-4-6-11(14)7-5-10/h3-8,14H,1-2H3/b12-8- |
| InChIKey | CHMFCXONFHJQAH-WQLSENKSSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol?
The IUPAC name of 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol (CID 163484573) is 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol.
What is the SMILES notation for 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol?
The canonical SMILES for 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol is CC(C)=C/C=C(\Cl)c1ccc(O)cc1.
What is the InChIKey of 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol?
The InChIKey is CHMFCXONFHJQAH-WQLSENKSSA-N. The full InChI is InChI=1S/C12H13ClO/c1-9(2)3-8-12(13)10-4-6-11(14)7-5-10/h3-8,14H,1-2H3/b12-8-.
What are the key properties of 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol?
4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol has a molecular weight of 208.69 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]phenol is sourced from PubChem (CID 163484573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).