C13H14ClF9NP — CID 86593913
[4-chloro-4-[4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]-dimethylazanium hexafluorophosphate (PubChem CID 86593913) has the molecular formula C13H14ClF9NP and a molecular weight of 421.67 g/mol. Its IUPAC name is [4-chloro-4-[4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [4-chloro-4-[4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 86593913 |
| Molecular Formula | C13H14ClF9NP |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [4-chloro-4-[4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CC(C=C(Cl)c1ccc(C(F)(F)F)cc1)=[N+](C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H14ClF3N.F6P/c1-9(18(2)3)8-12(14)10-4-6-11(7-5-10)13(15,16)17;1-7(2,3,4,5)6/h4-8H,1-3H3;/q+1;-1 |
| InChIKey | LJGYKHCQJHEYEL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|