C14H13F3O — CID 141194637
(3Z,5E)-3-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-2-one (PubChem CID 141194637) has the molecular formula C14H13F3O and a molecular weight of 254.25 g/mol. Its IUPAC name is (3Z,5E)-3-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-2-one.
| Compound Name | (3Z,5E)-3-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 141194637 |
| Molecular Formula | C14H13F3O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (3Z,5E)-3-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-2-one |
| SMILES | C/C=C/C=C(\C(C)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3O/c1-3-4-5-13(10(2)18)11-6-8-12(9-7-11)14(15,16)17/h3-9H,1-2H3/b4-3+,13-5+ |
| InChIKey | IZXIEHCZGRHDCJ-HJSZHNSDSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|