C18H28F3NO — CID 142535486
ethane;1-[(2Z,4E)-4-methoxyhexa-2,4-dien-3-yl]-4-(trifluoromethyl)benzene;N-methylmethanamine (PubChem CID 142535486) has the molecular formula C18H28F3NO and a molecular weight of 331.42 g/mol. Its IUPAC name is ethane;1-[(2Z,4E)-4-methoxyhexa-2,4-dien-3-yl]-4-(trifluoromethyl)benzene;N-methylmethanamine.
| Compound Name | ethane;1-[(2Z,4E)-4-methoxyhexa-2,4-dien-3-yl]-4-(trifluoromethyl)benzene;N-methylmethanamine |
|---|---|
| PubChem CID | 142535486 |
| Molecular Formula | C18H28F3NO |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | ethane;1-[(2Z,4E)-4-methoxyhexa-2,4-dien-3-yl]-4-(trifluoromethyl)benzene;N-methylmethanamine |
| SMILES | C/C=C(C(=C/C)\OC)/c1ccc(C(F)(F)F)cc1.CC.CNC |
| InChI | InChI=1S/C14H15F3O.C2H7N.C2H6/c1-4-12(13(5-2)18-3)10-6-8-11(9-7-10)14(15,16)17;1-3-2;1-2/h4-9H,1-3H3;3H,1-2H3;1-2H3/b12-4-,13-5+;; |
| InChIKey | HJXXVCZPTJGHAZ-RKDUINAVSA-N |
| XLogP | 5.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|