C16H16F4O3S — CID 20692922
2-[(1E,3E)-4-[3-fluoro-5-(trifluoromethoxy)phenyl]buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane (PubChem CID 20692922) has the molecular formula C16H16F4O3S and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-[(1E,3E)-4-[3-fluoro-5-(trifluoromethoxy)phenyl]buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane.
| Compound Name | 2-[(1E,3E)-4-[3-fluoro-5-(trifluoromethoxy)phenyl]buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 20692922 |
| Molecular Formula | C16H16F4O3S |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[(1E,3E)-4-[3-fluoro-5-(trifluoromethoxy)phenyl]buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C/c2cc(F)cc(OC(F)(F)F)c2)OC1 |
| InChI | InChI=1S/C16H16F4O3S/c1-24-14-9-21-15(22-10-14)5-3-2-4-11-6-12(17)8-13(7-11)23-16(18,19)20/h2-8,14-15H,9-10H2,1H3/b4-2+,5-3+ |
| InChIKey | VZLDQBLOJXMUII-ZUVMSYQZSA-N |
| XLogP | 4.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|