C15H16F2O2S — CID 20692921
2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane (PubChem CID 20692921) has the molecular formula C15H16F2O2S and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane.
| Compound Name | 2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 20692921 |
| Molecular Formula | C15H16F2O2S |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-5-methylsulfanyl-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C/c2ccc(F)cc2F)OC1 |
| InChI | InChI=1S/C15H16F2O2S/c1-20-13-9-18-15(19-10-13)5-3-2-4-11-6-7-12(16)8-14(11)17/h2-8,13,15H,9-10H2,1H3/b4-2+,5-3+ |
| InChIKey | FIFNHJNYWPRSCU-ZUVMSYQZSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|