C15H15F3O3S — CID 20692855
(E)-1-(5-methylsulfanyl-1,3-dioxan-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 20692855) has the molecular formula C15H15F3O3S and a molecular weight of 332.34 g/mol. Its IUPAC name is (E)-1-(5-methylsulfanyl-1,3-dioxan-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-methylsulfanyl-1,3-dioxan-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20692855 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (E)-1-(5-methylsulfanyl-1,3-dioxan-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CSC1COC(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C15H15F3O3S/c1-22-12-8-20-14(21-9-12)13(19)7-4-10-2-5-11(6-3-10)15(16,17)18/h2-7,12,14H,8-9H2,1H3/b7-4+ |
| InChIKey | WQIHVNCWVTUESM-QPJJXVBHSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|