C13H11F3O3 — CID 160663185
(4Z)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one (PubChem CID 160663185) has the molecular formula C13H11F3O3 and a molecular weight of 272.22 g/mol. Its IUPAC name is (4Z)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one.
| Compound Name | (4Z)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 160663185 |
| Molecular Formula | C13H11F3O3 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (4Z)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one |
| SMILES | CC1OCC(=O)/C(=C/c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C13H11F3O3/c1-8-18-7-11(17)12(19-8)6-9-2-4-10(5-3-9)13(14,15)16/h2-6,8H,7H2,1H3/b12-6- |
| InChIKey | RLYDGSWWNVPLGX-SDQBBNPISA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|