C23H18F6O4 — CID 72669548
2-ethoxy-2-methyl-4,6-bis[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one (PubChem CID 72669548) has the molecular formula C23H18F6O4 and a molecular weight of 472.38 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-4,6-bis[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one.
| Compound Name | 2-ethoxy-2-methyl-4,6-bis[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 72669548 |
| Molecular Formula | C23H18F6O4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-ethoxy-2-methyl-4,6-bis[[4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxan-5-one |
| SMILES | CCOC1(C)OC(=Cc2ccc(C(F)(F)F)cc2)C(=O)C(=Cc2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C23H18F6O4/c1-3-31-21(2)32-18(12-14-4-8-16(9-5-14)22(24,25)26)20(30)19(33-21)13-15-6-10-17(11-7-15)23(27,28)29/h4-13H,3H2,1-2H3 |
| InChIKey | ZZTQIWKWZAHJQJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|