C15H17F3O2S — CID 10829347
(1E,4E)-5-ethoxy-6,6,6-trifluoro-4-methylsulfanyl-1-phenylhexa-1,4-dien-3-ol (PubChem CID 10829347) has the molecular formula C15H17F3O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is (1E,4E)-5-ethoxy-6,6,6-trifluoro-4-methylsulfanyl-1-phenylhexa-1,4-dien-3-ol.
| Compound Name | (1E,4E)-5-ethoxy-6,6,6-trifluoro-4-methylsulfanyl-1-phenylhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10829347 |
| Molecular Formula | C15H17F3O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (1E,4E)-5-ethoxy-6,6,6-trifluoro-4-methylsulfanyl-1-phenylhexa-1,4-dien-3-ol |
| SMILES | CCO/C(=C(/SC)C(O)/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O2S/c1-3-20-14(15(16,17)18)13(21-2)12(19)10-9-11-7-5-4-6-8-11/h4-10,12,19H,3H2,1-2H3/b10-9+,14-13+ |
| InChIKey | HDNQKVSAJOCPMJ-LBSPPQMYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|