C11H13F3O2S — CID 139666791
3-benzylsulfanyl-1,1,1-trifluoro-3-methoxypropan-2-ol (PubChem CID 139666791) has the molecular formula C11H13F3O2S and a molecular weight of 266.28 g/mol. Its IUPAC name is 3-benzylsulfanyl-1,1,1-trifluoro-3-methoxypropan-2-ol.
| Compound Name | 3-benzylsulfanyl-1,1,1-trifluoro-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 139666791 |
| Molecular Formula | C11H13F3O2S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-benzylsulfanyl-1,1,1-trifluoro-3-methoxypropan-2-ol |
| SMILES | COC(SCc1ccccc1)C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O2S/c1-16-10(9(15)11(12,13)14)17-7-8-5-3-2-4-6-8/h2-6,9-10,15H,7H2,1H3 |
| InChIKey | HWYSCSCAMSNPIF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|