C13H13FOS — CID 68827371
4-benzylsulfanyl-4-fluorocyclohexa-2,5-dien-1-ol (PubChem CID 68827371) has the molecular formula C13H13FOS and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-benzylsulfanyl-4-fluorocyclohexa-2,5-dien-1-ol.
| Compound Name | 4-benzylsulfanyl-4-fluorocyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 68827371 |
| Molecular Formula | C13H13FOS |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-benzylsulfanyl-4-fluorocyclohexa-2,5-dien-1-ol |
| SMILES | OC1C=CC(F)(SCc2ccccc2)C=C1 |
| InChI | InChI=1S/C13H13FOS/c14-13(8-6-12(15)7-9-13)16-10-11-4-2-1-3-5-11/h1-9,12,15H,10H2 |
| InChIKey | CFIGEBSXHHNNNZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|