C16H13F3O2S — CID 150378287
3-benzylsulfanyl-2,2,4-trifluoro-3-hydroxy-3a,4-dihydroinden-1-one (PubChem CID 150378287) has the molecular formula C16H13F3O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 3-benzylsulfanyl-2,2,4-trifluoro-3-hydroxy-3a,4-dihydroinden-1-one.
| Compound Name | 3-benzylsulfanyl-2,2,4-trifluoro-3-hydroxy-3a,4-dihydroinden-1-one |
|---|---|
| PubChem CID | 150378287 |
| Molecular Formula | C16H13F3O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-benzylsulfanyl-2,2,4-trifluoro-3-hydroxy-3a,4-dihydroinden-1-one |
| SMILES | O=C1C2=CC=CC(F)C2C(O)(SCc2ccccc2)C1(F)F |
| InChI | InChI=1S/C16H13F3O2S/c17-12-8-4-7-11-13(12)16(21,15(18,19)14(11)20)22-9-10-5-2-1-3-6-10/h1-8,12-13,21H,9H2 |
| InChIKey | GZEFVDFJVNQYED-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|