C26H33F3OS — CID 142207253
1-ethyl-4-methylbenzene;(3Z,5E)-2-methylsulfanyl-5-(trifluoromethoxy)hepta-1,3,5-triene;1,4-xylene (PubChem CID 142207253) has the molecular formula C26H33F3OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-ethyl-4-methylbenzene;(3Z,5E)-2-methylsulfanyl-5-(trifluoromethoxy)hepta-1,3,5-triene;1,4-xylene.
| Compound Name | 1-ethyl-4-methylbenzene;(3Z,5E)-2-methylsulfanyl-5-(trifluoromethoxy)hepta-1,3,5-triene;1,4-xylene |
|---|---|
| PubChem CID | 142207253 |
| Molecular Formula | C26H33F3OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-ethyl-4-methylbenzene;(3Z,5E)-2-methylsulfanyl-5-(trifluoromethoxy)hepta-1,3,5-triene;1,4-xylene |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)SC.CCc1ccc(C)cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H11F3OS.C9H12.C8H10/c1-4-8(13-9(10,11)12)6-5-7(2)14-3;1-3-9-6-4-8(2)5-7-9;1-7-3-5-8(2)6-4-7/h4-6H,2H2,1,3H3;4-7H,3H2,1-2H3;3-6H,1-2H3/b6-5-,8-4+;; |
| InChIKey | HEZHINBHQQTGHE-KRQLUXMQSA-N |
| XLogP | 8.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|