C21H26F2O — CID 123762410
1-(3,4-difluoro-5-methoxyhepta-1,3,5-trien-2-yl)-4-(4-methylcyclohexyl)benzene (PubChem CID 123762410) has the molecular formula C21H26F2O and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(3,4-difluoro-5-methoxyhepta-1,3,5-trien-2-yl)-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-(3,4-difluoro-5-methoxyhepta-1,3,5-trien-2-yl)-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 123762410 |
| Molecular Formula | C21H26F2O |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-(3,4-difluoro-5-methoxyhepta-1,3,5-trien-2-yl)-4-(4-methylcyclohexyl)benzene |
| SMILES | C=C(C(F)=C(F)C(=CC)OC)c1ccc(C2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C21H26F2O/c1-5-19(24-4)21(23)20(22)15(3)16-10-12-18(13-11-16)17-8-6-14(2)7-9-17/h5,10-14,17H,3,6-9H2,1-2,4H3 |
| InChIKey | MJBDSZUPVQQSFQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|