C28H33F3O — CID 143909410
2,3-difluoro-1-[(4Z,8E)-8-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]-4-(4-methylcyclohexyl)benzene (PubChem CID 143909410) has the molecular formula C28H33F3O and a molecular weight of 442.57 g/mol. Its IUPAC name is 2,3-difluoro-1-[(4Z,8E)-8-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]-4-(4-methylcyclohexyl)benzene.
| Compound Name | 2,3-difluoro-1-[(4Z,8E)-8-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143909410 |
| Molecular Formula | C28H33F3O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2,3-difluoro-1-[(4Z,8E)-8-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]-4-(4-methylcyclohexyl)benzene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C/C(=C)OC)CCc1ccc(C2CCC(C)CC2)c(F)c1F |
| InChI | InChI=1S/C28H33F3O/c1-18(7-11-20(3)22(5)26(29)17-21(4)32-6)10-14-24-15-16-25(28(31)27(24)30)23-12-8-19(2)9-13-23/h7,11,15-17,19,23H,1,3-5,8-10,12-14H2,2,6H3/b11-7-,26-17+ |
| InChIKey | CYKSHPGPFUFEGV-BROCPHIHSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|