C31H39F3O — CID 88953408
1-(4-ethylcyclohexen-1-yl)-2,3-difluoro-4-[2-[4-[(2E,4E)-2-fluoro-4-methoxyocta-2,4,6,7-tetraenyl]cyclohexyl]ethyl]benzene (PubChem CID 88953408) has the molecular formula C31H39F3O and a molecular weight of 484.65 g/mol. Its IUPAC name is 1-(4-ethylcyclohexen-1-yl)-2,3-difluoro-4-[2-[4-[(2E,4E)-2-fluoro-4-methoxyocta-2,4,6,7-tetraenyl]cyclohexyl]ethyl]benzene.
| Compound Name | 1-(4-ethylcyclohexen-1-yl)-2,3-difluoro-4-[2-[4-[(2E,4E)-2-fluoro-4-methoxyocta-2,4,6,7-tetraenyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 88953408 |
| Molecular Formula | C31H39F3O |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-(4-ethylcyclohexen-1-yl)-2,3-difluoro-4-[2-[4-[(2E,4E)-2-fluoro-4-methoxyocta-2,4,6,7-tetraenyl]cyclohexyl]ethyl]benzene |
| SMILES | C=C=C/C=C(\C=C(\F)CC1CCC(CCc2ccc(C3=CCC(CC)CC3)c(F)c2F)CC1)OC |
| InChI | InChI=1S/C31H39F3O/c1-4-6-7-28(35-3)21-27(32)20-24-10-8-23(9-11-24)14-17-26-18-19-29(31(34)30(26)33)25-15-12-22(5-2)13-16-25/h6-7,15,18-19,21-24H,1,5,8-14,16-17,20H2,2-3H3/b27-21+,28-7+ |
| InChIKey | WDHAOKKNXLNUJZ-WIFVNYGMSA-N |
| XLogP | 9.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|