C28H24F4O — CID 143909492
1-[(1E,4Z,8Z)-8,9-difluoro-10-methoxy-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 143909492) has the molecular formula C28H24F4O and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-[(1E,4Z,8Z)-8,9-difluoro-10-methoxy-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-[(1E,4Z,8Z)-8,9-difluoro-10-methoxy-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 143909492 |
| Molecular Formula | C28H24F4O |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-[(1E,4Z,8Z)-8,9-difluoro-10-methoxy-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C(\F)C(=C)OC)/C=C/c1ccc(-c2ccc(C)cc2)c(F)c1F |
| InChI | InChI=1S/C28H24F4O/c1-17(7-11-19(3)20(4)25(29)26(30)21(5)33-6)10-14-23-15-16-24(28(32)27(23)31)22-12-8-18(2)9-13-22/h7-16H,1,3-5H2,2,6H3/b11-7-,14-10+,26-25- |
| InChIKey | FDKCUTZMXNJUHC-BQWAWYBBSA-N |
| XLogP | 8.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|