C16H17F5O2 — CID 10544813
(1E,4Z)-5-ethoxy-6,6,7,7,7-pentafluoro-3-methyl-1-phenylhepta-1,4-dien-3-ol (PubChem CID 10544813) has the molecular formula C16H17F5O2 and a molecular weight of 336.30 g/mol. Its IUPAC name is (1E,4Z)-5-ethoxy-6,6,7,7,7-pentafluoro-3-methyl-1-phenylhepta-1,4-dien-3-ol.
| Compound Name | (1E,4Z)-5-ethoxy-6,6,7,7,7-pentafluoro-3-methyl-1-phenylhepta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10544813 |
| Molecular Formula | C16H17F5O2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (1E,4Z)-5-ethoxy-6,6,7,7,7-pentafluoro-3-methyl-1-phenylhepta-1,4-dien-3-ol |
| SMILES | CCO/C(=C\C(C)(O)/C=C/c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F5O2/c1-3-23-13(15(17,18)16(19,20)21)11-14(2,22)10-9-12-7-5-4-6-8-12/h4-11,22H,3H2,1-2H3/b10-9+,13-11- |
| InChIKey | OKUXRGYDPSQPLR-LTCRFSFDSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|