C13H11F3O — CID 118988144
(1E,3S)-1-phenyl-3-(trifluoromethyl)hexa-1,4,5-trien-3-ol (PubChem CID 118988144) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is (1E,3S)-1-phenyl-3-(trifluoromethyl)hexa-1,4,5-trien-3-ol.
| Compound Name | (1E,3S)-1-phenyl-3-(trifluoromethyl)hexa-1,4,5-trien-3-ol |
|---|---|
| PubChem CID | 118988144 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1E,3S)-1-phenyl-3-(trifluoromethyl)hexa-1,4,5-trien-3-ol |
| SMILES | C=C=C[C@@](O)(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O/c1-2-9-12(17,13(14,15)16)10-8-11-6-4-3-5-7-11/h3-10,17H,1H2/b10-8+/t12-/m1/s1 |
| InChIKey | KJBHBPMRAAGKQO-ZJNQMXKESA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |