C13H9F5O2 — CID 162655979
(4Z,6E)-1,1,1,2,2-pentafluoro-5-hydroxy-7-phenylhepta-4,6-dien-3-one (PubChem CID 162655979) has the molecular formula C13H9F5O2 and a molecular weight of 292.20 g/mol. Its IUPAC name is (4Z,6E)-1,1,1,2,2-pentafluoro-5-hydroxy-7-phenylhepta-4,6-dien-3-one.
| Compound Name | (4Z,6E)-1,1,1,2,2-pentafluoro-5-hydroxy-7-phenylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 162655979 |
| Molecular Formula | C13H9F5O2 |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (4Z,6E)-1,1,1,2,2-pentafluoro-5-hydroxy-7-phenylhepta-4,6-dien-3-one |
| SMILES | O=C(/C=C(O)/C=C/c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F5O2/c14-12(15,13(16,17)18)11(20)8-10(19)7-6-9-4-2-1-3-5-9/h1-8,19H/b7-6+,10-8- |
| InChIKey | IOHRFNGLFLAFKL-QDJLDCPTSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|