C25H26F6O2S2 — CID 10626188
(2E,5Z)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3,5-bis(phenylsulfanyl)-4-(trifluoromethyl)octa-2,5-dien-4-ol (PubChem CID 10626188) has the molecular formula C25H26F6O2S2 and a molecular weight of 536.60 g/mol. Its IUPAC name is (2E,5Z)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3,5-bis(phenylsulfanyl)-4-(trifluoromethyl)octa-2,5-dien-4-ol.
| Compound Name | (2E,5Z)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3,5-bis(phenylsulfanyl)-4-(trifluoromethyl)octa-2,5-dien-4-ol |
|---|---|
| PubChem CID | 10626188 |
| Molecular Formula | C25H26F6O2S2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (2E,5Z)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3,5-bis(phenylsulfanyl)-4-(trifluoromethyl)octa-2,5-dien-4-ol |
| SMILES | CCO/C(=C(/Sc1ccccc1)C(O)(/C(=C/C(C)(C)C)Sc1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H26F6O2S2/c1-5-33-20(24(26,27)28)21(35-18-14-10-7-11-15-18)23(32,25(29,30)31)19(16-22(2,3)4)34-17-12-8-6-9-13-17/h6-16,32H,5H2,1-4H3/b19-16-,21-20+ |
| InChIKey | GVQHZKWKJILTDY-RGWYIFMJSA-N |
| XLogP | 8.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|