C22H26O2S2 — CID 122390349
(3Z,5Z)-2,7-dimethyl-3,6-bis(phenylsulfanyl)octa-3,5-diene-2,7-diol (PubChem CID 122390349) has the molecular formula C22H26O2S2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (3Z,5Z)-2,7-dimethyl-3,6-bis(phenylsulfanyl)octa-3,5-diene-2,7-diol.
| Compound Name | (3Z,5Z)-2,7-dimethyl-3,6-bis(phenylsulfanyl)octa-3,5-diene-2,7-diol |
|---|---|
| PubChem CID | 122390349 |
| Molecular Formula | C22H26O2S2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (3Z,5Z)-2,7-dimethyl-3,6-bis(phenylsulfanyl)octa-3,5-diene-2,7-diol |
| SMILES | CC(C)(O)/C(=C/C=C(\Sc1ccccc1)C(C)(C)O)Sc1ccccc1 |
| InChI | InChI=1S/C22H26O2S2/c1-21(2,23)19(25-17-11-7-5-8-12-17)15-16-20(22(3,4)24)26-18-13-9-6-10-14-18/h5-16,23-24H,1-4H3/b19-15-,20-16- |
| InChIKey | HSYRRMSVDDNGPX-IKBKFCNISA-N |
| XLogP | 5.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|