C31H34O2S3 — CID 10721077
(1Z,4Z,6Z)-1-ethoxy-8,8-dimethyl-2,4,6-tris(phenylsulfanyl)nona-1,4,6-trien-3-ol (PubChem CID 10721077) has the molecular formula C31H34O2S3 and a molecular weight of 534.81 g/mol. Its IUPAC name is (1Z,4Z,6Z)-1-ethoxy-8,8-dimethyl-2,4,6-tris(phenylsulfanyl)nona-1,4,6-trien-3-ol.
| Compound Name | (1Z,4Z,6Z)-1-ethoxy-8,8-dimethyl-2,4,6-tris(phenylsulfanyl)nona-1,4,6-trien-3-ol |
|---|---|
| PubChem CID | 10721077 |
| Molecular Formula | C31H34O2S3 |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | (1Z,4Z,6Z)-1-ethoxy-8,8-dimethyl-2,4,6-tris(phenylsulfanyl)nona-1,4,6-trien-3-ol |
| SMILES | CCO/C=C(\Sc1ccccc1)C(O)/C(=C/C(=C/C(C)(C)C)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C31H34O2S3/c1-5-33-23-29(36-26-19-13-8-14-20-26)30(32)28(35-25-17-11-7-12-18-25)21-27(22-31(2,3)4)34-24-15-9-6-10-16-24/h6-23,30,32H,5H2,1-4H3/b27-22-,28-21-,29-23- |
| InChIKey | ZVFZJSUBXVEAPB-AWXDPDBASA-N |
| XLogP | 9.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|