C18H18O2S2 — CID 122390350
(2Z,4Z)-2,5-bis(phenylsulfanyl)hexa-2,4-diene-1,6-diol (PubChem CID 122390350) has the molecular formula C18H18O2S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2Z,4Z)-2,5-bis(phenylsulfanyl)hexa-2,4-diene-1,6-diol.
| Compound Name | (2Z,4Z)-2,5-bis(phenylsulfanyl)hexa-2,4-diene-1,6-diol |
|---|---|
| PubChem CID | 122390350 |
| Molecular Formula | C18H18O2S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (2Z,4Z)-2,5-bis(phenylsulfanyl)hexa-2,4-diene-1,6-diol |
| SMILES | OC/C(=C/C=C(/CO)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C18H18O2S2/c19-13-17(21-15-7-3-1-4-8-15)11-12-18(14-20)22-16-9-5-2-6-10-16/h1-12,19-20H,13-14H2/b17-11-,18-12- |
| InChIKey | RQNDDKFZEBJMPH-WHYMJUELSA-N |
| XLogP | 4.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|