C15H14OS2 — CID 11173397
(Z)-2,3-bis(phenylsulfanyl)prop-2-en-1-ol (PubChem CID 11173397) has the molecular formula C15H14OS2 and a molecular weight of 274.41 g/mol. Its IUPAC name is (Z)-2,3-bis(phenylsulfanyl)prop-2-en-1-ol.
| Compound Name | (Z)-2,3-bis(phenylsulfanyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 11173397 |
| Molecular Formula | C15H14OS2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (Z)-2,3-bis(phenylsulfanyl)prop-2-en-1-ol |
| SMILES | OC/C(=C/Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C15H14OS2/c16-11-15(18-14-9-5-2-6-10-14)12-17-13-7-3-1-4-8-13/h1-10,12,16H,11H2/b15-12- |
| InChIKey | GETNBRDORYHCHQ-QINSGFPZSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |