C23H22OS3 — CID 13234738
(E)-1,1,1-tris(phenylsulfanyl)pent-3-en-2-ol (PubChem CID 13234738) has the molecular formula C23H22OS3 and a molecular weight of 410.63 g/mol. Its IUPAC name is (E)-1,1,1-tris(phenylsulfanyl)pent-3-en-2-ol.
| Compound Name | (E)-1,1,1-tris(phenylsulfanyl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 13234738 |
| Molecular Formula | C23H22OS3 |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (E)-1,1,1-tris(phenylsulfanyl)pent-3-en-2-ol |
| SMILES | C/C=C/C(O)C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C23H22OS3/c1-2-12-22(24)23(25-19-13-6-3-7-14-19,26-20-15-8-4-9-16-20)27-21-17-10-5-11-18-21/h2-18,22,24H,1H3/b12-2+ |
| InChIKey | MZTBZWQPNGHOTF-SWGQDTFXSA-N |
| XLogP | 6.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|