C18H22OS2 — CID 11067121
3,3-bis(phenylsulfanyl)hexan-2-ol (PubChem CID 11067121) has the molecular formula C18H22OS2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 3,3-bis(phenylsulfanyl)hexan-2-ol.
| Compound Name | 3,3-bis(phenylsulfanyl)hexan-2-ol |
|---|---|
| PubChem CID | 11067121 |
| Molecular Formula | C18H22OS2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3,3-bis(phenylsulfanyl)hexan-2-ol |
| SMILES | CCCC(Sc1ccccc1)(Sc1ccccc1)C(C)O |
| InChI | InChI=1S/C18H22OS2/c1-3-14-18(15(2)19,20-16-10-6-4-7-11-16)21-17-12-8-5-9-13-17/h4-13,15,19H,3,14H2,1-2H3 |
| InChIKey | VOYYLBZBOBUTBR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|