C21H18F5OS+ — CID 159105203
1,1,1,3,3-pentafluoropropan-2-ol;triphenylsulfanium (PubChem CID 159105203) has the molecular formula C21H18F5OS+ and a molecular weight of 413.43 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoropropan-2-ol;triphenylsulfanium.
| Compound Name | 1,1,1,3,3-pentafluoropropan-2-ol;triphenylsulfanium |
|---|---|
| PubChem CID | 159105203 |
| Molecular Formula | C21H18F5OS+ |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1,1,1,3,3-pentafluoropropan-2-ol;triphenylsulfanium |
| SMILES | OC(C(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3H3F5O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-2(5)1(9)3(6,7)8/h1-15H;1-2,9H/q+1; |
| InChIKey | KDUIICDEXQUWPS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|