C20H18F2O4S2 — CID 58112898
[(1,1-difluoro-2-hydroxyethyl)-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium (PubChem CID 58112898) has the molecular formula C20H18F2O4S2 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(1,1-difluoro-2-hydroxyethyl)-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium.
| Compound Name | [(1,1-difluoro-2-hydroxyethyl)-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium |
|---|---|
| PubChem CID | 58112898 |
| Molecular Formula | C20H18F2O4S2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [(1,1-difluoro-2-hydroxyethyl)-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium |
| SMILES | O=S([O-])(O[S+](c1ccccc1)c1ccccc1)(c1ccccc1)C(F)(F)CO |
| InChI | InChI=1S/C20H18F2O4S2/c21-20(22,16-23)28(24,25,19-14-8-3-9-15-19)26-27(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15,23H,16H2 |
| InChIKey | PFDULYFOWCLPKL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|