C23H28O2S2 — CID 11112157
(1Z,4Z)-1-ethoxy-6,6-dimethyl-2,4-bis(phenylsulfanyl)hepta-1,4-dien-3-ol (PubChem CID 11112157) has the molecular formula C23H28O2S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (1Z,4Z)-1-ethoxy-6,6-dimethyl-2,4-bis(phenylsulfanyl)hepta-1,4-dien-3-ol.
| Compound Name | (1Z,4Z)-1-ethoxy-6,6-dimethyl-2,4-bis(phenylsulfanyl)hepta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 11112157 |
| Molecular Formula | C23H28O2S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (1Z,4Z)-1-ethoxy-6,6-dimethyl-2,4-bis(phenylsulfanyl)hepta-1,4-dien-3-ol |
| SMILES | CCO/C=C(\Sc1ccccc1)C(O)/C(=C/C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C23H28O2S2/c1-5-25-17-21(27-19-14-10-7-11-15-19)22(24)20(16-23(2,3)4)26-18-12-8-6-9-13-18/h6-17,22,24H,5H2,1-4H3/b20-16-,21-17- |
| InChIKey | QGLHAMWOEFFFJD-ISPAOBMBSA-N |
| XLogP | 6.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|