C22H26O2SSe — CID 134841048
(3Z,5Z)-2,7-dimethyl-3-phenylselanyl-6-phenylsulfanylocta-3,5-diene-2,7-diol (PubChem CID 134841048) has the molecular formula C22H26O2SSe and a molecular weight of 433.48 g/mol. Its IUPAC name is (3Z,5Z)-2,7-dimethyl-3-phenylselanyl-6-phenylsulfanylocta-3,5-diene-2,7-diol.
| Compound Name | (3Z,5Z)-2,7-dimethyl-3-phenylselanyl-6-phenylsulfanylocta-3,5-diene-2,7-diol |
|---|---|
| PubChem CID | 134841048 |
| Molecular Formula | C22H26O2SSe |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | (3Z,5Z)-2,7-dimethyl-3-phenylselanyl-6-phenylsulfanylocta-3,5-diene-2,7-diol |
| SMILES | CC(C)(O)/C(=C/C=C(\[Se]c1ccccc1)C(C)(C)O)Sc1ccccc1 |
| InChI | InChI=1S/C22H26O2SSe/c1-21(2,23)19(25-17-11-7-5-8-12-17)15-16-20(22(3,4)24)26-18-13-9-6-10-14-18/h5-16,23-24H,1-4H3/b19-15-,20-16- |
| InChIKey | BPAJTIXOXPZWHS-IKBKFCNISA-N |
| XLogP | 4.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|