C20H22OS2 — CID 13171794
2,2,5,5-tetramethyl-3,4-bis(phenylsulfanyl)furan (PubChem CID 13171794) has the molecular formula C20H22OS2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3,4-bis(phenylsulfanyl)furan.
| Compound Name | 2,2,5,5-tetramethyl-3,4-bis(phenylsulfanyl)furan |
|---|---|
| PubChem CID | 13171794 |
| Molecular Formula | C20H22OS2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2,2,5,5-tetramethyl-3,4-bis(phenylsulfanyl)furan |
| SMILES | CC1(C)OC(C)(C)C(Sc2ccccc2)=C1Sc1ccccc1 |
| InChI | InChI=1S/C20H22OS2/c1-19(2)17(22-15-11-7-5-8-12-15)18(20(3,4)21-19)23-16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | UBIYIDKPRFOCNQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |