C16H17FOS — CID 142628612
5-ethenyl-6-ethoxy-6-fluoro-5-phenylsulfanylcyclohexa-1,3-diene (PubChem CID 142628612) has the molecular formula C16H17FOS and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-ethenyl-6-ethoxy-6-fluoro-5-phenylsulfanylcyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-6-ethoxy-6-fluoro-5-phenylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142628612 |
| Molecular Formula | C16H17FOS |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-ethenyl-6-ethoxy-6-fluoro-5-phenylsulfanylcyclohexa-1,3-diene |
| SMILES | C=CC1(Sc2ccccc2)C=CC=CC1(F)OCC |
| InChI | InChI=1S/C16H17FOS/c1-3-15(19-14-10-6-5-7-11-14)12-8-9-13-16(15,17)18-4-2/h3,5-13H,1,4H2,2H3 |
| InChIKey | NPBXBWGCAAIJFD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|