C16H18F3OS+ — CID 140641926
(4-methoxy-3,5-dimethylcyclohexa-2,4-dien-1-yl)-phenyl-(trifluoromethyl)sulfanium (PubChem CID 140641926) has the molecular formula C16H18F3OS+ and a molecular weight of 315.38 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethylcyclohexa-2,4-dien-1-yl)-phenyl-(trifluoromethyl)sulfanium.
| Compound Name | (4-methoxy-3,5-dimethylcyclohexa-2,4-dien-1-yl)-phenyl-(trifluoromethyl)sulfanium |
|---|---|
| PubChem CID | 140641926 |
| Molecular Formula | C16H18F3OS+ |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (4-methoxy-3,5-dimethylcyclohexa-2,4-dien-1-yl)-phenyl-(trifluoromethyl)sulfanium |
| SMILES | COC1=C(C)CC([S+](c2ccccc2)C(F)(F)F)C=C1C |
| InChI | InChI=1S/C16H18F3OS/c1-11-9-14(10-12(2)15(11)20-3)21(16(17,18)19)13-7-5-4-6-8-13/h4-9,14H,10H2,1-3H3/q+1 |
| InChIKey | HTDHHAHLGSLWSO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|