C13H13F3OS — CID 11043976
[(E)-2-but-3-en-2-yloxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene (PubChem CID 11043976) has the molecular formula C13H13F3OS and a molecular weight of 274.31 g/mol. Its IUPAC name is [(E)-2-but-3-en-2-yloxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene.
| Compound Name | [(E)-2-but-3-en-2-yloxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 11043976 |
| Molecular Formula | C13H13F3OS |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [(E)-2-but-3-en-2-yloxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
| SMILES | C=CC(C)O/C(=C/Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3OS/c1-3-10(2)17-12(13(14,15)16)9-18-11-7-5-4-6-8-11/h3-10H,1H2,2H3/b12-9+ |
| InChIKey | GRFFXWSCOLTTOX-FMIVXFBMSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|