C42H63FOS — CID 76779019
[1-(fluoromethoxy)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-13-yl]sulfanylbenzene (PubChem CID 76779019) has the molecular formula C42H63FOS and a molecular weight of 635.03 g/mol. Its IUPAC name is [1-(fluoromethoxy)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-13-yl]sulfanylbenzene.
| Compound Name | [1-(fluoromethoxy)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-13-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 76779019 |
| Molecular Formula | C42H63FOS |
| Molecular Weight | 635.03 g/mol |
| Exact Mass | 634.46 |
| IUPAC Name | [1-(fluoromethoxy)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-13-yl]sulfanylbenzene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(CC(C)=CCCC(C)=CCCC(C)=CCOCF)Sc1ccccc1 |
| InChI | InChI=1S/C42H63FOS/c1-34(2)17-12-18-35(3)19-13-20-36(4)22-15-25-39(7)31-42(45-41-27-10-9-11-28-41)32-40(8)26-16-23-37(5)21-14-24-38(6)29-30-44-33-43/h9-11,17,19,21-22,26-29,31,42H,12-16,18,20,23-25,30,32-33H2,1-8H3 |
| InChIKey | CTSPWWDYRGWFMI-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.03 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|