C15H20OS — CID 15227553
(2R,6R)-6-ethyl-5-methyl-2-(phenylsulfanylmethyl)-3,6-dihydro-2H-pyran (PubChem CID 15227553) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (2R,6R)-6-ethyl-5-methyl-2-(phenylsulfanylmethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-6-ethyl-5-methyl-2-(phenylsulfanylmethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 15227553 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2R,6R)-6-ethyl-5-methyl-2-(phenylsulfanylmethyl)-3,6-dihydro-2H-pyran |
| SMILES | CC[C@H]1O[C@@H](CSc2ccccc2)CC=C1C |
| InChI | InChI=1S/C15H20OS/c1-3-15-12(2)9-10-13(16-15)11-17-14-7-5-4-6-8-14/h4-9,13,15H,3,10-11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | XCTZXBNZIOMYLB-UKRRQHHQSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|