C14H18OS — CID 13171781
2,5-dimethyl-3-phenylsulfanylhexa-3,4-dien-2-ol (PubChem CID 13171781) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 2,5-dimethyl-3-phenylsulfanylhexa-3,4-dien-2-ol.
| Compound Name | 2,5-dimethyl-3-phenylsulfanylhexa-3,4-dien-2-ol |
|---|---|
| PubChem CID | 13171781 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2,5-dimethyl-3-phenylsulfanylhexa-3,4-dien-2-ol |
| SMILES | CC(C)=C=C(Sc1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C14H18OS/c1-11(2)10-13(14(3,4)15)16-12-8-6-5-7-9-12/h5-9,15H,1-4H3 |
| InChIKey | IKBISQBEKUNQRN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |